Поиск Google ничего не нашел

Определить тип окислительно-восстановительной реакции.

poisk-ru.ru

Cr2O3 + KNO3 + KOH = K2CrO4 + KNO2 + H2O. КОМПЛЕКСНЫЕ СОЕДИНЕНИЯ.

kj kmno4 h2so4=mnso4 j2 k2so4 h2o

worldchess.kz

6. Укажите какая из стадий п.5 относится к ОВР: а) ... Какое из перечисленных веществ Nа2S, H2O, SO2, HBr проявляет только ...

1) Mg + H2SO4 = MgSO4 + S + H2O уровнять и указать ок-ль и в-ль...

himia.neznaka.ru

нужно расставить коэфициенты методом электронного баланса 1)K2Cr2O7+NaI+H2SO4---->Cr2(SO4)3+I2+Na2SO4+K2SO4+H2O 2).

Окислительно-восстановительные реакции

dpn2004.narod.ru

Окислительные свойства перманганата калия в кислой среде: 2KMnO4+10KJ+8H2SO4(р)

Балансировка химического уравнения - онлайн балансировкa...

ru.webqc.org

Info: MNI2 might be an improperly capitalized: MnI2 Info: KCL might be an improperly capitalized: KCl Сбалансированное уравнение: 2 KMNO4 + 14 KI + 16 HCL = 2 MNI2 + 5 I2 + 8 H2O + 16 KCL. Расскажите, пожалуйста, об этом бесплатном программном "химическом" обеспечении вашим...

Расставить коэффициенты в следующей схемы реакции и указать...

www.LiveExpert.ru

Меня заинтересовал ваш ответ "2KMnO4 + 10KI +8H2SO4 = 2MnSO4 + 5I2 + 6K2SO4 + 8H2O Составим уравнение электронного баланса Mn(+7..." на вопрос http

Ответы@Mail.Ru: расставьте коэффициенты пожалуйста...

otvet.mail.ru

2KMnO4+8H2SO4+10KI=2MnSO4+8H2O+5I2+6K2SO4 2I- -2e=I2 Mn+7 +5e=Mn+2 ok?

10KI+2KMNO4+8H2SO4=5I2+2MNSO4+6K2SO4+8H2O

www.StudFiles.ru

12. 1. KMnO4+Na3AsO3+H2SO4=MnSO4+Na3A sO4+K2SO4+H20 Mn^+7 +5e=Mn^+2 -реакция восстановления, окислитель As^+3 -2e=As^+5 -реакция окисления, восстановитель наименьшее общее кратное 10,следовательно перед магнием коэффициент 2,перед мышьяком - 5 получаем

Э1/Э2 = m1/m2 - Лекции по химии - n1.doc

bib.convdocs.org

а) 2KMnO4 = K2MnO4 + MnO2 + O2; б) HCOOH = CO + H2O; реакции обмена (молекулы взаимодействующих веществ обмениваются своими частями).

Поиск реализован с помощью Yandex XML и Google Custom Search API